C15H21ClN2O3 — CID 111798745
N-(3-chloro-4-methylphenyl)-N'-(1-hydroxy-4-methylpentan-3-yl)oxamide (PubChem CID 111798745) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-(1-hydroxy-4-methylpentan-3-yl)oxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-(1-hydroxy-4-methylpentan-3-yl)oxamide |
|---|---|
| PubChem CID | 111798745 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-(1-hydroxy-4-methylpentan-3-yl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC(CCO)C(C)C)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c1-9(2)13(6-7-19)18-15(21)14(20)17-11-5-4-10(3)12(16)8-11/h4-5,8-9,13,19H,6-7H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | LNBUEJMXDFYTMR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|