C14H14ClFN2O3 — CID 111798888
N'-(4-chloro-3-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]oxamide (PubChem CID 111798888) has the molecular formula C14H14ClFN2O3 and a molecular weight of 312.73 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]oxamide |
|---|---|
| PubChem CID | 111798888 |
| Molecular Formula | C14H14ClFN2O3 |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]oxamide |
| SMILES | O=C(Nc1ccc(Cl)c(F)c1)C(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C14H14ClFN2O3/c15-11-4-3-10(6-12(11)16)18-14(21)13(20)17-9-2-1-8(5-9)7-19/h1-4,6,8-9,19H,5,7H2,(H,17,20)(H,18,21)/t8-,9+/m0/s1 |
| InChIKey | LEUZIMCWHZIMDO-DTWKUNHWSA-N |
| XLogP | 1.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|