C14H17ClFN5O2 — CID 78129283
N'-(4-chloro-3-fluorophenyl)-N-[2-(diaminomethylideneamino)cyclopentyl]oxamide (PubChem CID 78129283) has the molecular formula C14H17ClFN5O2 and a molecular weight of 341.77 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[2-(diaminomethylideneamino)cyclopentyl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[2-(diaminomethylideneamino)cyclopentyl]oxamide |
|---|---|
| PubChem CID | 78129283 |
| Molecular Formula | C14H17ClFN5O2 |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[2-(diaminomethylideneamino)cyclopentyl]oxamide |
| SMILES | NC(N)=NC1CCCC1NC(=O)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H17ClFN5O2/c15-8-5-4-7(6-9(8)16)19-12(22)13(23)20-10-2-1-3-11(10)21-14(17)18/h4-6,10-11H,1-3H2,(H,19,22)(H,20,23)(H4,17,18,21) |
| InChIKey | AJVLSJHRBQXMCZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|