C23H24ClFN6O2 — CID 71603454
N'-(4-chloro-3-fluorophenyl)-N-[(10S,11S)-10-(diaminomethylideneamino)-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indol-11-yl]oxamide (PubChem CID 71603454) has the molecular formula C23H24ClFN6O2 and a molecular weight of 470.94 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[(10S,11S)-10-(diaminomethylideneamino)-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indol-11-yl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[(10S,11S)-10-(diaminomethylideneamino)-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indol-11-yl]oxamide |
|---|---|
| PubChem CID | 71603454 |
| Molecular Formula | C23H24ClFN6O2 |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[(10S,11S)-10-(diaminomethylideneamino)-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indol-11-yl]oxamide |
| SMILES | NC(N)=N[C@H]1CCCCc2[nH]c3ccccc3c2[C@@H]1NC(=O)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C23H24ClFN6O2/c24-14-10-9-12(11-15(14)25)28-21(32)22(33)31-20-18(30-23(26)27)8-4-3-7-17-19(20)13-5-1-2-6-16(13)29-17/h1-2,5-6,9-11,18,20,29H,3-4,7-8H2,(H,28,32)(H,31,33)(H4,26,27,30)/t18-,20+/m0/s1 |
| InChIKey | KMBKPMACGSLIGX-AZUAARDMSA-N |
| XLogP | 3.12 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|