C24H29ClFN7O2 — CID 166451586
N-[(1R,2R)-5-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide (PubChem CID 166451586) has the molecular formula C24H29ClFN7O2 and a molecular weight of 501.99 g/mol. Its IUPAC name is N-[(1R,2R)-5-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide.
| Compound Name | N-[(1R,2R)-5-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 166451586 |
| Molecular Formula | C24H29ClFN7O2 |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-[(1R,2R)-5-[[(3R)-3-aminopyrrolidin-1-yl]methyl]-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide |
| SMILES | NC(N)=NC[C@H]1Cc2cc(CN3CC[C@@H](N)C3)ccc2[C@@H]1NC(=O)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C24H29ClFN7O2/c25-19-4-2-17(9-20(19)26)31-22(34)23(35)32-21-15(10-30-24(28)29)8-14-7-13(1-3-18(14)21)11-33-6-5-16(27)12-33/h1-4,7,9,15-16,21H,5-6,8,10-12,27H2,(H,31,34)(H,32,35)(H4,28,29,30)/t15-,16-,21-/m1/s1 |
| InChIKey | UJGBLAVDKVSVBC-WHSLLNHNSA-N |
| XLogP | 1.25 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|