C21H23ClFN5O4 — CID 71718883
2-[(1R,2R)-1-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-2,3-dihydro-1H-inden-2-yl]ethyl-(diaminomethylidene)azanium formate (PubChem CID 71718883) has the molecular formula C21H23ClFN5O4 and a molecular weight of 463.90 g/mol. Its IUPAC name is 2-[(1R,2R)-1-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-2,3-dihydro-1H-inden-2-yl]ethyl-(diaminomethylidene)azanium formate.
| Compound Name | 2-[(1R,2R)-1-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-2,3-dihydro-1H-inden-2-yl]ethyl-(diaminomethylidene)azanium formate |
|---|---|
| PubChem CID | 71718883 |
| Molecular Formula | C21H23ClFN5O4 |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-[(1R,2R)-1-[[2-(4-chloro-3-fluoroanilino)-2-oxoacetyl]amino]-2,3-dihydro-1H-inden-2-yl]ethyl-(diaminomethylidene)azanium formate |
| SMILES | NC(N)=[NH+]CC[C@H]1Cc2ccccc2[C@@H]1NC(=O)C(=O)Nc1ccc(Cl)c(F)c1.O=C[O-] |
| InChI | InChI=1S/C20H21ClFN5O2.CH2O2/c21-15-6-5-13(10-16(15)22)26-18(28)19(29)27-17-12(7-8-25-20(23)24)9-11-3-1-2-4-14(11)17;2-1-3/h1-6,10,12,17H,7-9H2,(H,26,28)(H,27,29)(H4,23,24,25);1H,(H,2,3)/t12-,17+;/m0./s1 |
| InChIKey | ROQKQBHXMOXYAT-LWHGMNCYSA-N |
| XLogP | -1.44 |
| TPSA | 164.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|