C20H19ClFNO3 — CID 157193523
3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide (PubChem CID 157193523) has the molecular formula C20H19ClFNO3 and a molecular weight of 375.83 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 157193523 |
| Molecular Formula | C20H19ClFNO3 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-(2-hydroxyethyl)-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide |
| SMILES | O=C(Cc1ccc(Cl)c(F)c1)C(=O)N[C@H]1c2ccccc2C[C@@H]1CCO |
| InChI | InChI=1S/C20H19ClFNO3/c21-16-6-5-12(9-17(16)22)10-18(25)20(26)23-19-14(7-8-24)11-13-3-1-2-4-15(13)19/h1-6,9,14,19,24H,7-8,10-11H2,(H,23,26)/t14-,19+/m0/s1 |
| InChIKey | WWHOTLHYYLJGEY-IFXJQAMLSA-N |
| XLogP | 3.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|