C20H20ClFN4O4 — CID 160903412
[(1S,2S)-1-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]-2,3-dihydro-1H-inden-2-yl]-(diaminomethylidene)azanium formate (PubChem CID 160903412) has the molecular formula C20H20ClFN4O4 and a molecular weight of 434.86 g/mol. Its IUPAC name is [(1S,2S)-1-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]-2,3-dihydro-1H-inden-2-yl]-(diaminomethylidene)azanium formate.
| Compound Name | [(1S,2S)-1-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]-2,3-dihydro-1H-inden-2-yl]-(diaminomethylidene)azanium formate |
|---|---|
| PubChem CID | 160903412 |
| Molecular Formula | C20H20ClFN4O4 |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | [(1S,2S)-1-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]-2,3-dihydro-1H-inden-2-yl]-(diaminomethylidene)azanium formate |
| SMILES | NC(N)=[NH+][C@H]1Cc2ccccc2[C@@H]1NC(=O)C(=O)Cc1ccc(Cl)c(F)c1.O=C[O-] |
| InChI | InChI=1S/C19H18ClFN4O2.CH2O2/c20-13-6-5-10(7-14(13)21)8-16(26)18(27)25-17-12-4-2-1-3-11(12)9-15(17)24-19(22)23;2-1-3/h1-7,15,17H,8-9H2,(H,25,27)(H4,22,23,24);1H,(H,2,3)/t15-,17-;/m0./s1 |
| InChIKey | SPURVFYHNJNOSZ-NBLXOJGSSA-N |
| XLogP | -1.91 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|