C25H31ClFN5O2 — CID 158420580
3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-[(diaminomethylideneamino)methyl]-5-[[methyl(propyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide (PubChem CID 158420580) has the molecular formula C25H31ClFN5O2 and a molecular weight of 488.01 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-[(diaminomethylideneamino)methyl]-5-[[methyl(propyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-[(diaminomethylideneamino)methyl]-5-[[methyl(propyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 158420580 |
| Molecular Formula | C25H31ClFN5O2 |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-[(diaminomethylideneamino)methyl]-5-[[methyl(propyl)amino]methyl]-2,3-dihydro-1H-inden-1-yl]-2-oxopropanamide |
| SMILES | CCCN(C)Cc1ccc2c(c1)C[C@H](CN=C(N)N)[C@H]2NC(=O)C(=O)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C25H31ClFN5O2/c1-3-8-32(2)14-16-4-6-19-17(9-16)12-18(13-30-25(28)29)23(19)31-24(34)22(33)11-15-5-7-20(26)21(27)10-15/h4-7,9-10,18,23H,3,8,11-14H2,1-2H3,(H,31,34)(H4,28,29,30)/t18-,23-/m1/s1 |
| InChIKey | HALCKMLZAALKQA-WZONZLPQSA-N |
| XLogP | 2.74 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|