C23H28ClFN6O4 — CID 145018853
N'-(4-chloro-3-fluorophenyl)oxamide;2-[[(2R)-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-5-yl]methyl-methylamino]acetic acid (PubChem CID 145018853) has the molecular formula C23H28ClFN6O4 and a molecular weight of 506.97 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)oxamide;2-[[(2R)-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-5-yl]methyl-methylamino]acetic acid.
| Compound Name | N'-(4-chloro-3-fluorophenyl)oxamide;2-[[(2R)-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-5-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 145018853 |
| Molecular Formula | C23H28ClFN6O4 |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)oxamide;2-[[(2R)-2-[(diaminomethylideneamino)methyl]-2,3-dihydro-1H-inden-5-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)Cc1ccc2c(c1)C[C@H](CN=C(N)N)C2.NC(=O)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H22N4O2.C8H6ClFN2O2/c1-19(9-14(20)21)8-10-2-3-12-5-11(6-13(12)4-10)7-18-15(16)17;9-5-2-1-4(3-6(5)10)12-8(14)7(11)13/h2-4,11H,5-9H2,1H3,(H,20,21)(H4,16,17,18);1-3H,(H2,11,13)(H,12,14)/t11-;/m1./s1 |
| InChIKey | FSCICNZIDKOQKP-RFVHGSKJSA-N |
| XLogP | 1.09 |
| TPSA | 177.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|