C20H20ClF2N5O2 — CID 164540625
N-[5-[[[amino-[fluoro(methyl)amino]methylidene]amino]methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide (PubChem CID 164540625) has the molecular formula C20H20ClF2N5O2 and a molecular weight of 435.86 g/mol. Its IUPAC name is N-[5-[[[amino-[fluoro(methyl)amino]methylidene]amino]methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide.
| Compound Name | N-[5-[[[amino-[fluoro(methyl)amino]methylidene]amino]methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 164540625 |
| Molecular Formula | C20H20ClF2N5O2 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[5-[[[amino-[fluoro(methyl)amino]methylidene]amino]methyl]-2,3-dihydro-1H-inden-1-yl]-N'-(4-chloro-3-fluorophenyl)oxamide |
| SMILES | CN(F)/C(N)=N/Cc1ccc2c(c1)CCC2NC(=O)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H20ClF2N5O2/c1-28(23)20(24)25-10-11-2-5-14-12(8-11)3-7-17(14)27-19(30)18(29)26-13-4-6-15(21)16(22)9-13/h2,4-6,8-9,17H,3,7,10H2,1H3,(H2,24,25)(H,26,29)(H,27,30) |
| InChIKey | TUDBEYRLPVZMGK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|