C17H15ClFN4O3- — CID 91110990
N'-[1-(2-aminoanilino)-1-oxopropan-2-yl]-N-(4-chloro-3-fluorophenyl)oxamide (PubChem CID 91110990) has the molecular formula C17H15ClFN4O3- and a molecular weight of 377.78 g/mol. Its IUPAC name is N'-[1-(2-aminoanilino)-1-oxopropan-2-yl]-N-(4-chloro-3-fluorophenyl)oxamide.
| Compound Name | N'-[1-(2-aminoanilino)-1-oxopropan-2-yl]-N-(4-chloro-3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 91110990 |
| Molecular Formula | C17H15ClFN4O3- |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N'-[1-(2-aminoanilino)-1-oxopropan-2-yl]-N-(4-chloro-3-fluorophenyl)oxamide |
| SMILES | [CH2-]C(NC(=O)C(=O)Nc1ccc(Cl)c(F)c1)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C17H15ClFN4O3/c1-9(15(24)23-14-5-3-2-4-13(14)20)21-16(25)17(26)22-10-6-7-11(18)12(19)8-10/h2-9H,1,20H2,(H,21,25)(H,22,26)(H,23,24)/q-1 |
| InChIKey | CRFHGTACIIIOJD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|