C28H28N2O6S — CID 11179939
benzyl (1R,4S,7R)-2-benzyl-7-methylsulfonyloxy-3-oxo-1-phenyl-2,5-diazaspiro[3.4]octane-5-carboxylate (PubChem CID 11179939) has the molecular formula C28H28N2O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is benzyl (1R,4S,7R)-2-benzyl-7-methylsulfonyloxy-3-oxo-1-phenyl-2,5-diazaspiro[3.4]octane-5-carboxylate.
| Compound Name | benzyl (1R,4S,7R)-2-benzyl-7-methylsulfonyloxy-3-oxo-1-phenyl-2,5-diazaspiro[3.4]octane-5-carboxylate |
|---|---|
| PubChem CID | 11179939 |
| Molecular Formula | C28H28N2O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | benzyl (1R,4S,7R)-2-benzyl-7-methylsulfonyloxy-3-oxo-1-phenyl-2,5-diazaspiro[3.4]octane-5-carboxylate |
| SMILES | CS(=O)(=O)O[C@H]1CN(C(=O)OCc2ccccc2)[C@]2(C1)C(=O)N(Cc1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C28H28N2O6S/c1-37(33,34)36-24-17-28(30(19-24)27(32)35-20-22-13-7-3-8-14-22)25(23-15-9-4-10-16-23)29(26(28)31)18-21-11-5-2-6-12-21/h2-16,24-25H,17-20H2,1H3/t24-,25-,28+/m1/s1 |
| InChIKey | ACOOICYOUWAVBT-SKVJQKLOSA-N |
| XLogP | 3.90 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|