C12H20N4OS — CID 111802562
N'-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine-4-carboximidamide (PubChem CID 111802562) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is N'-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111802562 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N'-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]morpholine-4-carboximidamide |
| SMILES | CC(C)c1nc(C/N=C(\N)N2CCOCC2)cs1 |
| InChI | InChI=1S/C12H20N4OS/c1-9(2)11-15-10(8-18-11)7-14-12(13)16-3-5-17-6-4-16/h8-9H,3-7H2,1-2H3,(H2,13,14) |
| InChIKey | OGCCCOMIHWTUAG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|