C16H24BrIN4O2 — CID 111808057
3-[[amino(morpholin-4-yl)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide;hydroiodide (PubChem CID 111808057) has the molecular formula C16H24BrIN4O2 and a molecular weight of 511.20 g/mol. Its IUPAC name is 3-[[amino(morpholin-4-yl)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide;hydroiodide.
| Compound Name | 3-[[amino(morpholin-4-yl)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111808057 |
| Molecular Formula | C16H24BrIN4O2 |
| Molecular Weight | 511.20 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | 3-[[amino(morpholin-4-yl)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide;hydroiodide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CC/N=C(\N)N1CCOCC1.I |
| InChI | InChI=1S/C16H23BrN4O2.HI/c1-20(12-13-4-2-3-5-14(13)17)15(22)6-7-19-16(18)21-8-10-23-11-9-21;/h2-5H,6-12H2,1H3,(H2,18,19);1H |
| InChIKey | BORDVUJUZHOWOA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|