C21H25BrN4O2 — CID 111808046
3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide (PubChem CID 111808046) has the molecular formula C21H25BrN4O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is 3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide.
| Compound Name | 3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 111808046 |
| Molecular Formula | C21H25BrN4O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-[(2-bromophenyl)methyl]-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CC/N=C(\N)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C21H25BrN4O2/c1-26(14-15-6-2-4-8-17(15)22)20(27)10-12-24-21(23)25-18-11-13-28-19-9-5-3-7-16(18)19/h2-9,18H,10-14H2,1H3,(H3,23,24,25) |
| InChIKey | MIZIFZCBFFTSDZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|