C12H22F3IN4O3S — CID 111810817
N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111810817) has the molecular formula C12H22F3IN4O3S and a molecular weight of 486.30 g/mol. Its IUPAC name is N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111810817 |
| Molecular Formula | C12H22F3IN4O3S |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)N1CCOCC1 |
| InChI | InChI=1S/C12H21F3N4O3S.HI/c13-12(14,15)23(20,21)19-3-1-10(2-4-19)9-17-11(16)18-5-7-22-8-6-18;/h10H,1-9H2,(H2,16,17);1H |
| InChIKey | ZYCJDDASBFHEEB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|