C13H26F3IN4O3S — CID 111559703
1-ethyl-3-(2-methoxyethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111559703) has the molecular formula C13H26F3IN4O3S and a molecular weight of 502.34 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111559703 |
| Molecular Formula | C13H26F3IN4O3S |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCCOC.I |
| InChI | InChI=1S/C13H25F3N4O3S.HI/c1-3-17-12(18-6-9-23-2)19-10-11-4-7-20(8-5-11)24(21,22)13(14,15)16;/h11H,3-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | ZPVIEGJXBFLQHP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|