C20H27N3O3 — CID 111811230
1-(2,5-dimethoxyphenyl)-2-[2-(2-propan-2-ylphenoxy)ethyl]guanidine (PubChem CID 111811230) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[2-(2-propan-2-ylphenoxy)ethyl]guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[2-(2-propan-2-ylphenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111811230 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[2-(2-propan-2-ylphenoxy)ethyl]guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CCOc2ccccc2C(C)C)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-14(2)16-7-5-6-8-18(16)26-12-11-22-20(21)23-17-13-15(24-3)9-10-19(17)25-4/h5-10,13-14H,11-12H2,1-4H3,(H3,21,22,23) |
| InChIKey | HFQSCHRUMLZWSO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|