C16H25IN4O3 — CID 111812442
ethyl N-[2-[[amino-(3-methoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide (PubChem CID 111812442) has the molecular formula C16H25IN4O3 and a molecular weight of 448.31 g/mol. Its IUPAC name is ethyl N-[2-[[amino-(3-methoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[2-[[amino-(3-methoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111812442 |
| Molecular Formula | C16H25IN4O3 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | ethyl N-[2-[[amino-(3-methoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(C/N=C(\N)Nc1cccc(OC)c1)C1CC1.I |
| InChI | InChI=1S/C16H24N4O3.HI/c1-3-23-16(21)20-14(11-7-8-11)10-18-15(17)19-12-5-4-6-13(9-12)22-2;/h4-6,9,11,14H,3,7-8,10H2,1-2H3,(H,20,21)(H3,17,18,19);1H |
| InChIKey | LPJGJAIQVBAPGB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|