C19H29IN4O2 — CID 111812394
ethyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide (PubChem CID 111812394) has the molecular formula C19H29IN4O2 and a molecular weight of 472.37 g/mol. Its IUPAC name is ethyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111812394 |
| Molecular Formula | C19H29IN4O2 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | ethyl N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(C/N=C(\N)Nc1cccc2c1CCCC2)C1CC1.I |
| InChI | InChI=1S/C19H28N4O2.HI/c1-2-25-19(24)23-17(14-10-11-14)12-21-18(20)22-16-9-5-7-13-6-3-4-8-15(13)16;/h5,7,9,14,17H,2-4,6,8,10-12H2,1H3,(H,23,24)(H3,20,21,22);1H |
| InChIKey | KLQUUDAWSBMWRV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|