C21H26N4O3 — CID 111812413
ethyl N-[2-[[amino-(3-phenoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate (PubChem CID 111812413) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl N-[2-[[amino-(3-phenoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate.
| Compound Name | ethyl N-[2-[[amino-(3-phenoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate |
|---|---|
| PubChem CID | 111812413 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | ethyl N-[2-[[amino-(3-phenoxyanilino)methylidene]amino]-1-cyclopropylethyl]carbamate |
| SMILES | CCOC(=O)NC(C/N=C(\N)Nc1cccc(Oc2ccccc2)c1)C1CC1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-27-21(26)25-19(15-11-12-15)14-23-20(22)24-16-7-6-10-18(13-16)28-17-8-4-3-5-9-17/h3-10,13,15,19H,2,11-12,14H2,1H3,(H,25,26)(H3,22,23,24) |
| InChIKey | LMKYSJGQAKWOKV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|