C12H25IN4O2 — CID 111812432
ethyl N-[2-[[amino(propylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide (PubChem CID 111812432) has the molecular formula C12H25IN4O2 and a molecular weight of 384.26 g/mol. Its IUPAC name is ethyl N-[2-[[amino(propylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[2-[[amino(propylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111812432 |
| Molecular Formula | C12H25IN4O2 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | ethyl N-[2-[[amino(propylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
| SMILES | CCCN/C(N)=N/CC(NC(=O)OCC)C1CC1.I |
| InChI | InChI=1S/C12H24N4O2.HI/c1-3-7-14-11(13)15-8-10(9-5-6-9)16-12(17)18-4-2;/h9-10H,3-8H2,1-2H3,(H,16,17)(H3,13,14,15);1H |
| InChIKey | LURFWGOLLYWVFX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|