C16H30N4O2 — CID 111826638
ethyl N-[2-[[(cyclopentylamino)-(ethylamino)methylidene]amino]-1-cyclopropylethyl]carbamate (PubChem CID 111826638) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is ethyl N-[2-[[(cyclopentylamino)-(ethylamino)methylidene]amino]-1-cyclopropylethyl]carbamate.
| Compound Name | ethyl N-[2-[[(cyclopentylamino)-(ethylamino)methylidene]amino]-1-cyclopropylethyl]carbamate |
|---|---|
| PubChem CID | 111826638 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | ethyl N-[2-[[(cyclopentylamino)-(ethylamino)methylidene]amino]-1-cyclopropylethyl]carbamate |
| SMILES | CCN/C(=N\CC(NC(=O)OCC)C1CC1)NC1CCCC1 |
| InChI | InChI=1S/C16H30N4O2/c1-3-17-15(19-13-7-5-6-8-13)18-11-14(12-9-10-12)20-16(21)22-4-2/h12-14H,3-11H2,1-2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | GAEFNFGDRBCOKQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|