C14H29IN4O2 — CID 111812410
ethyl N-[2-[[amino-(3-methylbutylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide (PubChem CID 111812410) has the molecular formula C14H29IN4O2 and a molecular weight of 412.32 g/mol. Its IUPAC name is ethyl N-[2-[[amino-(3-methylbutylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[2-[[amino-(3-methylbutylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111812410 |
| Molecular Formula | C14H29IN4O2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | ethyl N-[2-[[amino-(3-methylbutylamino)methylidene]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(C/N=C(\N)NCCC(C)C)C1CC1.I |
| InChI | InChI=1S/C14H28N4O2.HI/c1-4-20-14(19)18-12(11-5-6-11)9-17-13(15)16-8-7-10(2)3;/h10-12H,4-9H2,1-3H3,(H,18,19)(H3,15,16,17);1H |
| InChIKey | ZOXVMAOPYQPXNO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|