C13H27IN4O2 — CID 111827290
ethyl N-[1-cyclopropyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]carbamate;hydroiodide (PubChem CID 111827290) has the molecular formula C13H27IN4O2 and a molecular weight of 398.29 g/mol. Its IUPAC name is ethyl N-[1-cyclopropyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-cyclopropyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111827290 |
| Molecular Formula | C13H27IN4O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | ethyl N-[1-cyclopropyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(CN/C(=N/C)NC(C)C)C1CC1.I |
| InChI | InChI=1S/C13H26N4O2.HI/c1-5-19-13(18)17-11(10-6-7-10)8-15-12(14-4)16-9(2)3;/h9-11H,5-8H2,1-4H3,(H,17,18)(H2,14,15,16);1H |
| InChIKey | QPJHDHGEBGSRPV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|