C18H33IN4O2 — CID 111828752
ethyl N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide (PubChem CID 111828752) has the molecular formula C18H33IN4O2 and a molecular weight of 464.39 g/mol. Its IUPAC name is ethyl N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide.
| Compound Name | ethyl N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111828752 |
| Molecular Formula | C18H33IN4O2 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | ethyl N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]-1-cyclopropylethyl]carbamate;hydroiodide |
| SMILES | CCOC(=O)NC(CN/C(=N\C)NCCC1=CCCCC1)C1CC1.I |
| InChI | InChI=1S/C18H32N4O2.HI/c1-3-24-18(23)22-16(15-9-10-15)13-21-17(19-2)20-12-11-14-7-5-4-6-8-14;/h7,15-16H,3-6,8-13H2,1-2H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | QLHCXONLIQATKA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|