C19H30N4O2 — CID 111830799
ethyl N-[1-cyclopropyl-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111830799) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is ethyl N-[1-cyclopropyl-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[1-cyclopropyl-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111830799 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | ethyl N-[1-cyclopropyl-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NC(CN/C(=N\C)NCC(C)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-4-25-19(24)23-17(16-10-11-16)13-22-18(20-3)21-12-14(2)15-8-6-5-7-9-15/h5-9,14,16-17H,4,10-13H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | AFBHFZBQYMMKDY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|