C17H34N4O2 — CID 111812397
ethyl N-[2-[[amino-(6-methylheptan-2-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate (PubChem CID 111812397) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is ethyl N-[2-[[amino-(6-methylheptan-2-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate.
| Compound Name | ethyl N-[2-[[amino-(6-methylheptan-2-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate |
|---|---|
| PubChem CID | 111812397 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | ethyl N-[2-[[amino-(6-methylheptan-2-ylamino)methylidene]amino]-1-cyclopropylethyl]carbamate |
| SMILES | CCOC(=O)NC(C/N=C(\N)NC(C)CCCC(C)C)C1CC1 |
| InChI | InChI=1S/C17H34N4O2/c1-5-23-17(22)21-15(14-9-10-14)11-19-16(18)20-13(4)8-6-7-12(2)3/h12-15H,5-11H2,1-4H3,(H,21,22)(H3,18,19,20) |
| InChIKey | BETAMIVAIHKUIG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|