C39H45N3O6 — CID 11181328
[1-(3,4,5-trimethoxybenzoyl)-4-tritylpiperazin-2-yl]methyl N,N-diethylcarbamate (PubChem CID 11181328) has the molecular formula C39H45N3O6 and a molecular weight of 651.80 g/mol. Its IUPAC name is [1-(3,4,5-trimethoxybenzoyl)-4-tritylpiperazin-2-yl]methyl N,N-diethylcarbamate.
| Compound Name | [1-(3,4,5-trimethoxybenzoyl)-4-tritylpiperazin-2-yl]methyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 11181328 |
| Molecular Formula | C39H45N3O6 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | [1-(3,4,5-trimethoxybenzoyl)-4-tritylpiperazin-2-yl]methyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCC1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C39H45N3O6/c1-6-40(7-2)38(44)48-28-33-27-41(23-24-42(33)37(43)29-25-34(45-3)36(47-5)35(26-29)46-4)39(30-17-11-8-12-18-30,31-19-13-9-14-20-31)32-21-15-10-16-22-32/h8-22,25-26,33H,6-7,23-24,27-28H2,1-5H3 |
| InChIKey | UBETVAALEDTZQP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|