C16H32IN3O2 — CID 111816215
tert-butyl 6-[[amino(piperidin-1-yl)methylidene]amino]hexanoate;hydroiodide (PubChem CID 111816215) has the molecular formula C16H32IN3O2 and a molecular weight of 425.36 g/mol. Its IUPAC name is tert-butyl 6-[[amino(piperidin-1-yl)methylidene]amino]hexanoate;hydroiodide.
| Compound Name | tert-butyl 6-[[amino(piperidin-1-yl)methylidene]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 111816215 |
| Molecular Formula | C16H32IN3O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | tert-butyl 6-[[amino(piperidin-1-yl)methylidene]amino]hexanoate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)CCCCC/N=C(\N)N1CCCCC1.I |
| InChI | InChI=1S/C16H31N3O2.HI/c1-16(2,3)21-14(20)10-6-4-7-11-18-15(17)19-12-8-5-9-13-19;/h4-13H2,1-3H3,(H2,17,18);1H |
| InChIKey | YEHADXVZGHQSCR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|