C19H28N4O2 — CID 111820158
2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111820158) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111820158 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-1-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CCC(CC)c1cc(C/N=C(\N)Nc2ccc(OC(C)C)cc2)on1 |
| InChI | InChI=1S/C19H28N4O2/c1-5-14(6-2)18-11-17(25-23-18)12-21-19(20)22-15-7-9-16(10-8-15)24-13(3)4/h7-11,13-14H,5-6,12H2,1-4H3,(H3,20,21,22) |
| InChIKey | KJNKWODCBDYCFQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|