C14H25F3N4O — CID 111822483
N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]morpholine-4-carboximidamide (PubChem CID 111822483) has the molecular formula C14H25F3N4O and a molecular weight of 322.38 g/mol. Its IUPAC name is N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]morpholine-4-carboximidamide.
| Compound Name | N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111822483 |
| Molecular Formula | C14H25F3N4O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\CCC1CCN(CC(F)(F)F)CC1)N1CCOCC1 |
| InChI | InChI=1S/C14H25F3N4O/c15-14(16,17)11-20-5-2-12(3-6-20)1-4-19-13(18)21-7-9-22-10-8-21/h12H,1-11H2,(H2,18,19) |
| InChIKey | CHXDOQJTBYWQKV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|