C17H25F3IN3 — CID 111822589
N'-[3-[3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111822589) has the molecular formula C17H25F3IN3 and a molecular weight of 455.31 g/mol. Its IUPAC name is N'-[3-[3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-[3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111822589 |
| Molecular Formula | C17H25F3IN3 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N'-[3-[3-(trifluoromethyl)phenyl]butyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CC(CC/N=C(\N)N1CCCCC1)c1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C17H24F3N3.HI/c1-13(14-6-5-7-15(12-14)17(18,19)20)8-9-22-16(21)23-10-3-2-4-11-23;/h5-7,12-13H,2-4,8-11H2,1H3,(H2,21,22);1H |
| InChIKey | VURPBVNGLXNPSK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|