C17H26N4O — CID 111824278
2-[[(1-tert-butylpyrazol-4-yl)methylamino]methyl]-3-pyridin-2-ylpropan-1-ol (PubChem CID 111824278) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[[(1-tert-butylpyrazol-4-yl)methylamino]methyl]-3-pyridin-2-ylpropan-1-ol.
| Compound Name | 2-[[(1-tert-butylpyrazol-4-yl)methylamino]methyl]-3-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 111824278 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-[[(1-tert-butylpyrazol-4-yl)methylamino]methyl]-3-pyridin-2-ylpropan-1-ol |
| SMILES | CC(C)(C)n1cc(CNCC(CO)Cc2ccccn2)cn1 |
| InChI | InChI=1S/C17H26N4O/c1-17(2,3)21-12-15(11-20-21)10-18-9-14(13-22)8-16-6-4-5-7-19-16/h4-7,11-12,14,18,22H,8-10,13H2,1-3H3 |
| InChIKey | BKQDCLUDFPUPTB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |