C14H18N4OS — CID 133475917
2-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]-3-pyridin-2-ylpropan-1-ol (PubChem CID 133475917) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]-3-pyridin-2-ylpropan-1-ol.
| Compound Name | 2-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]-3-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 133475917 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]-3-pyridin-2-ylpropan-1-ol |
| SMILES | CSc1cncc(NCC(CO)Cc2ccccn2)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-20-14-9-15-8-13(18-14)17-7-11(10-19)6-12-4-2-3-5-16-12/h2-5,8-9,11,19H,6-7,10H2,1H3,(H,17,18) |
| InChIKey | UGQIOFPJIPGEOU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |