C7H11N3OS — CID 131159984
2-[(6-methylsulfanylpyrazin-2-yl)amino]ethanol (PubChem CID 131159984) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-[(6-methylsulfanylpyrazin-2-yl)amino]ethanol.
| Compound Name | 2-[(6-methylsulfanylpyrazin-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 131159984 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-[(6-methylsulfanylpyrazin-2-yl)amino]ethanol |
| SMILES | CSc1cncc(NCCO)n1 |
| InChI | InChI=1S/C7H11N3OS/c1-12-7-5-8-4-6(10-7)9-2-3-11/h4-5,11H,2-3H2,1H3,(H,9,10) |
| InChIKey | MXWAKTLWAKGNQI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |