C11H17N3O2S — CID 122050109
(2S)-4-methyl-2-[(6-methylsulfanylpyrazin-2-yl)amino]pentanoic acid (PubChem CID 122050109) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(6-methylsulfanylpyrazin-2-yl)amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[(6-methylsulfanylpyrazin-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 122050109 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2S)-4-methyl-2-[(6-methylsulfanylpyrazin-2-yl)amino]pentanoic acid |
| SMILES | CSc1cncc(N[C@@H](CC(C)C)C(=O)O)n1 |
| InChI | InChI=1S/C11H17N3O2S/c1-7(2)4-8(11(15)16)13-9-5-12-6-10(14-9)17-3/h5-8H,4H2,1-3H3,(H,13,14)(H,15,16)/t8-/m0/s1 |
| InChIKey | IWPNRZZDNKLNEN-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |