C12H19N3O4 — CID 122049228
(2R)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]-4-methylpentanoic acid (PubChem CID 122049228) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2R)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122049228 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2R)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](Nc1cncc(OCCO)n1)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-8(2)5-9(12(17)18)14-10-6-13-7-11(15-10)19-4-3-16/h6-9,16H,3-5H2,1-2H3,(H,14,15)(H,17,18)/t9-/m1/s1 |
| InChIKey | RQDYPBYRFCSGGY-SECBINFHSA-N |
| XLogP | 0.76 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |