C11H19N3OS — CID 80890486
3-[6-(propylamino)pyrazin-2-yl]sulfanylbutan-1-ol (PubChem CID 80890486) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-[6-(propylamino)pyrazin-2-yl]sulfanylbutan-1-ol.
| Compound Name | 3-[6-(propylamino)pyrazin-2-yl]sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 80890486 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-[6-(propylamino)pyrazin-2-yl]sulfanylbutan-1-ol |
| SMILES | CCCNc1cncc(SC(C)CCO)n1 |
| InChI | InChI=1S/C11H19N3OS/c1-3-5-13-10-7-12-8-11(14-10)16-9(2)4-6-15/h7-9,15H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | KEFPHXZWYXWPOX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |