C11H20IN5O3S — CID 111824513
2-(2-methylprop-2-enyl)-1-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide (PubChem CID 111824513) has the molecular formula C11H20IN5O3S and a molecular weight of 429.28 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(2-methylprop-2-enyl)-1-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111824513 |
| Molecular Formula | C11H20IN5O3S |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NCCNS(=O)(=O)Cc1ccon1.I |
| InChI | InChI=1S/C11H19N5O3S.HI/c1-9(2)7-14-11(12)13-4-5-15-20(17,18)8-10-3-6-19-16-10;/h3,6,15H,1,4-5,7-8H2,2H3,(H3,12,13,14);1H |
| InChIKey | BSCOHGAJNSOWGE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|