C11H22IN5O3S — CID 111824505
1,3-diethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide (PubChem CID 111824505) has the molecular formula C11H22IN5O3S and a molecular weight of 431.30 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111824505 |
| Molecular Formula | C11H22IN5O3S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 1,3-diethyl-2-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]guanidine;hydroiodide |
| SMILES | CCNC(=NCCNS(=O)(=O)Cc1ccon1)NCC.I |
| InChI | InChI=1S/C11H21N5O3S.HI/c1-3-12-11(13-4-2)14-6-7-15-20(17,18)9-10-5-8-19-16-10;/h5,8,15H,3-4,6-7,9H2,1-2H3,(H2,12,13,14);1H |
| InChIKey | SNHHXEURLARVQR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|