C17H34N2O3 — CID 111825684
2-[2-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]ethoxy]ethanol (PubChem CID 111825684) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-[2-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 111825684 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2-[2-[4-[2-(2,6-dimethylmorpholin-4-yl)ethyl]piperidin-1-yl]ethoxy]ethanol |
| SMILES | CC1CN(CCC2CCN(CCOCCO)CC2)CC(C)O1 |
| InChI | InChI=1S/C17H34N2O3/c1-15-13-19(14-16(2)22-15)8-5-17-3-6-18(7-4-17)9-11-21-12-10-20/h15-17,20H,3-14H2,1-2H3 |
| InChIKey | UKDDYKBWVRMUCX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|