C13H26N2O3 — CID 110027884
2-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-N,N-dimethylacetamide (PubChem CID 110027884) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110027884 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 2-[1-[2-(2-hydroxyethoxy)ethyl]piperidin-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CC1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C13H26N2O3/c1-14(2)13(17)11-12-3-5-15(6-4-12)7-9-18-10-8-16/h12,16H,3-11H2,1-2H3 |
| InChIKey | QLGRZGHGUATTOR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|