C19H32N4O4 — CID 111832086
ethyl N-[1-cyclopropyl-2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]ethyl]carbamate (PubChem CID 111832086) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is ethyl N-[1-cyclopropyl-2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]ethyl]carbamate.
| Compound Name | ethyl N-[1-cyclopropyl-2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111832086 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | ethyl N-[1-cyclopropyl-2-[[ethylamino-[3-(furan-2-ylmethoxy)propylamino]methylidene]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CC(NC(=O)OCC)C1CC1)NCCCOCc1ccco1 |
| InChI | InChI=1S/C19H32N4O4/c1-3-20-18(21-10-6-11-25-14-16-7-5-12-27-16)22-13-17(15-8-9-15)23-19(24)26-4-2/h5,7,12,15,17H,3-4,6,8-11,13-14H2,1-2H3,(H,23,24)(H2,20,21,22) |
| InChIKey | VIGSPOKSOMPXHT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|