C22H37N3O2S — CID 111832191
1-ethyl-2-[(4-ethylsulfanyloxan-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine (PubChem CID 111832191) has the molecular formula C22H37N3O2S and a molecular weight of 407.62 g/mol. Its IUPAC name is 1-ethyl-2-[(4-ethylsulfanyloxan-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-ethylsulfanyloxan-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111832191 |
| Molecular Formula | C22H37N3O2S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-ethyl-2-[(4-ethylsulfanyloxan-4-yl)methyl]-3-[3-(1-phenylethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC1(SCC)CCOCC1)NCCCOC(C)c1ccccc1 |
| InChI | InChI=1S/C22H37N3O2S/c1-4-23-21(25-18-22(28-5-2)12-16-26-17-13-22)24-14-9-15-27-19(3)20-10-7-6-8-11-20/h6-8,10-11,19H,4-5,9,12-18H2,1-3H3,(H2,23,24,25) |
| InChIKey | CITIFEHVMUHKLC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|