C18H31FIN5O — CID 111833522
2-[[N'-[[4-(diethylamino)-3-fluorophenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111833522) has the molecular formula C18H31FIN5O and a molecular weight of 479.38 g/mol. Its IUPAC name is 2-[[N'-[[4-(diethylamino)-3-fluorophenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[[4-(diethylamino)-3-fluorophenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111833522 |
| Molecular Formula | C18H31FIN5O |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-[[N'-[[4-(diethylamino)-3-fluorophenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N(CC)CC)c(F)c1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C18H30FN5O.HI/c1-6-20-18(22-13-17(25)23(4)5)21-12-14-9-10-16(15(19)11-14)24(7-2)8-3;/h9-11H,6-8,12-13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | LULKCVINDACBML-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|