C18H25ClN4S — CID 111835513
1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine (PubChem CID 111835513) has the molecular formula C18H25ClN4S and a molecular weight of 364.95 g/mol. Its IUPAC name is 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111835513 |
| Molecular Formula | C18H25ClN4S |
| Molecular Weight | 364.95 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1nc(C(C)(C)C)cs1)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H25ClN4S/c1-18(2,3)15-12-24-16(23-15)8-9-21-17(20-4)22-11-13-6-5-7-14(19)10-13/h5-7,10,12H,8-9,11H2,1-4H3,(H2,20,21,22) |
| InChIKey | UXVXBKXKPGJTQE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|