C16H24N4S2 — CID 111837127
1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111837127) has the molecular formula C16H24N4S2 and a molecular weight of 336.53 g/mol. Its IUPAC name is 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111837127 |
| Molecular Formula | C16H24N4S2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCc1nc(C(C)(C)C)cs1)NCc1cccs1 |
| InChI | InChI=1S/C16H24N4S2/c1-16(2,3)13-11-22-14(20-13)7-8-18-15(17-4)19-10-12-6-5-9-21-12/h5-6,9,11H,7-8,10H2,1-4H3,(H2,17,18,19) |
| InChIKey | JCHBQORMHKVDNU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|