C19H28IN3O2S — CID 111837158
1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111837158) has the molecular formula C19H28IN3O2S and a molecular weight of 489.42 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111837158 |
| Molecular Formula | C19H28IN3O2S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccs1)NCC(C)(C)c1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H27N3O2S.HI/c1-19(2,14-8-9-16(23-4)17(11-14)24-5)13-22-18(20-3)21-12-15-7-6-10-25-15;/h6-11H,12-13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | LBGVALHLHZRSHC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|